C20H24ClN5O5 — CID 22267538
5-[4-(2-amino-2-oxoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide (PubChem CID 22267538) has the molecular formula C20H24ClN5O5 and a molecular weight of 449.90 g/mol. Its IUPAC name is 5-[4-(2-amino-2-oxoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide.
| Compound Name | 5-[4-(2-amino-2-oxoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide |
|---|---|
| PubChem CID | 22267538 |
| Molecular Formula | C20H24ClN5O5 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 5-[4-(2-amino-2-oxoethyl)-3,5-dioxo-1,2,4-triazin-2-yl]-2-chloro-N-[cycloheptyl(hydroxy)methyl]benzamide |
| SMILES | NC(=O)Cn1c(=O)cnn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)c1=O |
| InChI | InChI=1S/C20H24ClN5O5/c21-15-8-7-13(26-20(31)25(11-16(22)27)17(28)10-23-26)9-14(15)19(30)24-18(29)12-5-3-1-2-4-6-12/h7-10,12,18,29H,1-6,11H2,(H2,22,27)(H,24,30) |
| InChIKey | WDPDJLGTLFPYDL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|