C22H28ClN5O5 — CID 22267493
2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-[2-(ethylamino)-2-oxoethyl]-3,5-dioxo-1,2,4-triazin-2-yl]benzamide (PubChem CID 22267493) has the molecular formula C22H28ClN5O5 and a molecular weight of 477.95 g/mol. Its IUPAC name is 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-[2-(ethylamino)-2-oxoethyl]-3,5-dioxo-1,2,4-triazin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-[2-(ethylamino)-2-oxoethyl]-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 22267493 |
| Molecular Formula | C22H28ClN5O5 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[4-[2-(ethylamino)-2-oxoethyl]-3,5-dioxo-1,2,4-triazin-2-yl]benzamide |
| SMILES | CCNC(=O)Cn1c(=O)cnn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)c1=O |
| InChI | InChI=1S/C22H28ClN5O5/c1-2-24-18(29)13-27-19(30)12-25-28(22(27)33)15-9-10-17(23)16(11-15)21(32)26-20(31)14-7-5-3-4-6-8-14/h9-12,14,20,31H,2-8,13H2,1H3,(H,24,29)(H,26,32) |
| InChIKey | DNQOZGFZZSDHGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 135.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|