C23H33ClN4O4 — CID 22041708
2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[3-[3-(dimethylamino)-2-hydroxypropyl]-2-oxoimidazol-1-yl]benzamide (PubChem CID 22041708) has the molecular formula C23H33ClN4O4 and a molecular weight of 464.99 g/mol. Its IUPAC name is 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[3-[3-(dimethylamino)-2-hydroxypropyl]-2-oxoimidazol-1-yl]benzamide.
| Compound Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[3-[3-(dimethylamino)-2-hydroxypropyl]-2-oxoimidazol-1-yl]benzamide |
|---|---|
| PubChem CID | 22041708 |
| Molecular Formula | C23H33ClN4O4 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-chloro-N-[cycloheptyl(hydroxy)methyl]-5-[3-[3-(dimethylamino)-2-hydroxypropyl]-2-oxoimidazol-1-yl]benzamide |
| SMILES | CN(C)CC(O)Cn1ccn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)c1=O |
| InChI | InChI=1S/C23H33ClN4O4/c1-26(2)14-18(29)15-27-11-12-28(23(27)32)17-9-10-20(24)19(13-17)22(31)25-21(30)16-7-5-3-4-6-8-16/h9-13,16,18,21,29-30H,3-8,14-15H2,1-2H3,(H,25,31) |
| InChIKey | VKRLJZQVQVHLNJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|