C11H14ClNO6S2 — CID 63245476
2-[4-chloro-N-(2-methylsulfonylethylsulfonyl)anilino]acetic acid (PubChem CID 63245476) has the molecular formula C11H14ClNO6S2 and a molecular weight of 355.82 g/mol. Its IUPAC name is 2-[4-chloro-N-(2-methylsulfonylethylsulfonyl)anilino]acetic acid.
| Compound Name | 2-[4-chloro-N-(2-methylsulfonylethylsulfonyl)anilino]acetic acid |
|---|---|
| PubChem CID | 63245476 |
| Molecular Formula | C11H14ClNO6S2 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-[4-chloro-N-(2-methylsulfonylethylsulfonyl)anilino]acetic acid |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N(CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO6S2/c1-20(16,17)6-7-21(18,19)13(8-11(14)15)10-4-2-9(12)3-5-10/h2-5H,6-8H2,1H3,(H,14,15) |
| InChIKey | XIMFARCTWYDTQH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |