2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid

C15H23NO4S — CID 103520939

IUPAC2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid
SMILESCc1ccc(N(CC(=O)O)S(=O)(=O)CCC(C)(C)C)cc1
InChIInChI=1S/C15H23NO4S/c1-12-5-7-13(8-6-12)16(11-14(17)18)21(19,20)10-9-15(2,3)4/h5-8H,9-11H2,1-4H3,(H,17,18)
InChIKeyJFYHUYUKHYMLLP-UHFFFAOYSA-N
MW313.42 g/mol
LogP2.65
Rot. Bonds6

About 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid

2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid (PubChem CID 103520939) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid.

Molecular Properties

Compound Name2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid
PubChem CID103520939
Molecular FormulaC15H23NO4S
Molecular Weight313.42 g/mol
Exact Mass313.13
IUPAC Name2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid
SMILESCc1ccc(N(CC(=O)O)S(=O)(=O)CCC(C)(C)C)cc1
InChIInChI=1S/C15H23NO4S/c1-12-5-7-13(8-6-12)16(11-14(17)18)21(19,20)10-9-15(2,3)4/h5-8H,9-11H2,1-4H3,(H,17,18)
InChIKeyJFYHUYUKHYMLLP-UHFFFAOYSA-N
XLogP2.65
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.42
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid?
The IUPAC name of 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid (CID 103520939) is 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid.
What is the SMILES notation for 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid?
The canonical SMILES for 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid is Cc1ccc(N(CC(=O)O)S(=O)(=O)CCC(C)(C)C)cc1.
What is the InChIKey of 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid?
The InChIKey is JFYHUYUKHYMLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO4S/c1-12-5-7-13(8-6-12)16(11-14(17)18)21(19,20)10-9-15(2,3)4/h5-8H,9-11H2,1-4H3,(H,17,18).
What are the key properties of 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid?
2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid has a molecular weight of 313.42 g/mol, XLogP of 2.65, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(3,3-dimethylbutylsulfonyl)-4-methylanilino]acetic acid is sourced from PubChem (CID 103520939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).