C18H17Cl2NO5S — CID 50894710
methyl 2-(N-(2,5-dichlorophenyl)sulfonyl-3-prop-2-enoxyanilino)acetate (PubChem CID 50894710) has the molecular formula C18H17Cl2NO5S and a molecular weight of 430.31 g/mol. Its IUPAC name is methyl 2-(N-(2,5-dichlorophenyl)sulfonyl-3-prop-2-enoxyanilino)acetate.
| Compound Name | methyl 2-(N-(2,5-dichlorophenyl)sulfonyl-3-prop-2-enoxyanilino)acetate |
|---|---|
| PubChem CID | 50894710 |
| Molecular Formula | C18H17Cl2NO5S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | methyl 2-(N-(2,5-dichlorophenyl)sulfonyl-3-prop-2-enoxyanilino)acetate |
| SMILES | C=CCOc1cccc(N(CC(=O)OC)S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO5S/c1-3-9-26-15-6-4-5-14(11-15)21(12-18(22)25-2)27(23,24)17-10-13(19)7-8-16(17)20/h3-8,10-11H,1,9,12H2,2H3 |
| InChIKey | GVDMQWQGYDHJOD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|