C19H20ClNO6S — CID 100514854
methyl 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-prop-2-enoxyanilino)acetate (PubChem CID 100514854) has the molecular formula C19H20ClNO6S and a molecular weight of 425.89 g/mol. Its IUPAC name is methyl 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-prop-2-enoxyanilino)acetate.
| Compound Name | methyl 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-prop-2-enoxyanilino)acetate |
|---|---|
| PubChem CID | 100514854 |
| Molecular Formula | C19H20ClNO6S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | methyl 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-prop-2-enoxyanilino)acetate |
| SMILES | C=CCOc1ccc(N(CC(=O)OC)S(=O)(=O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClNO6S/c1-4-11-27-15-7-5-14(6-8-15)21(13-19(22)26-3)28(23,24)16-9-10-18(25-2)17(20)12-16/h4-10,12H,1,11,13H2,2-3H3 |
| InChIKey | RYOCMJGJBJMXFT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|