C20H22ClNO6S — CID 100515066
2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-cyclopentyloxyanilino)acetic acid (PubChem CID 100515066) has the molecular formula C20H22ClNO6S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-cyclopentyloxyanilino)acetic acid.
| Compound Name | 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-cyclopentyloxyanilino)acetic acid |
|---|---|
| PubChem CID | 100515066 |
| Molecular Formula | C20H22ClNO6S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-(N-(3-chloro-4-methoxyphenyl)sulfonyl-4-cyclopentyloxyanilino)acetic acid |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)O)c2ccc(OC3CCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C20H22ClNO6S/c1-27-19-11-10-17(12-18(19)21)29(25,26)22(13-20(23)24)14-6-8-16(9-7-14)28-15-4-2-3-5-15/h6-12,15H,2-5,13H2,1H3,(H,23,24) |
| InChIKey | FZYUTXRYCXWUHM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |