C22H20BrNO4S — CID 102298159
4-bromo-N-[2-(4-methoxyphenyl)ethynyl]-N-[2-(5-methylfuran-2-yl)ethyl]benzenesulfonamide (PubChem CID 102298159) has the molecular formula C22H20BrNO4S and a molecular weight of 474.38 g/mol. Its IUPAC name is 4-bromo-N-[2-(4-methoxyphenyl)ethynyl]-N-[2-(5-methylfuran-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(4-methoxyphenyl)ethynyl]-N-[2-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102298159 |
| Molecular Formula | C22H20BrNO4S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 4-bromo-N-[2-(4-methoxyphenyl)ethynyl]-N-[2-(5-methylfuran-2-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(C#CN(CCc2ccc(C)o2)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H20BrNO4S/c1-17-3-8-21(28-17)14-16-24(15-13-18-4-9-20(27-2)10-5-18)29(25,26)22-11-6-19(23)7-12-22/h3-12H,14,16H2,1-2H3 |
| InChIKey | IECLNJLEUBYELQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|