C22H21BrN2O2S — CID 155982134
4-bromo-N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-(2-phenylethynyl)benzenesulfonamide (PubChem CID 155982134) has the molecular formula C22H21BrN2O2S and a molecular weight of 457.39 g/mol. Its IUPAC name is 4-bromo-N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-(2-phenylethynyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-(2-phenylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155982134 |
| Molecular Formula | C22H21BrN2O2S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 4-bromo-N-[2-(3,5-dimethyl-1H-pyrrol-2-yl)ethyl]-N-(2-phenylethynyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(CCN(C#Cc2ccccc2)S(=O)(=O)c2ccc(Br)cc2)[nH]1 |
| InChI | InChI=1S/C22H21BrN2O2S/c1-17-16-18(2)24-22(17)13-15-25(14-12-19-6-4-3-5-7-19)28(26,27)21-10-8-20(23)9-11-21/h3-11,16,24H,13,15H2,1-2H3 |
| InChIKey | BIWZNAHXJUQMEZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|