C11H10F3NO2S — CID 156781338
N-(2-phenylethynyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide (PubChem CID 156781338) has the molecular formula C11H10F3NO2S and a molecular weight of 277.27 g/mol. Its IUPAC name is N-(2-phenylethynyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide.
| Compound Name | N-(2-phenylethynyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide |
|---|---|
| PubChem CID | 156781338 |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-(2-phenylethynyl)-N-(2,2,2-trifluoroethyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(C#Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C11H10F3NO2S/c1-18(16,17)15(9-11(12,13)14)8-7-10-5-3-2-4-6-10/h2-6H,9H2,1H3 |
| InChIKey | VGQSQIPLHPTWEO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|