C21H20FNO4S2 — CID 102494666
N-[2,2-bis(benzenesulfonyl)-2-fluoroethyl]-N-methylaniline (PubChem CID 102494666) has the molecular formula C21H20FNO4S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[2,2-bis(benzenesulfonyl)-2-fluoroethyl]-N-methylaniline.
| Compound Name | N-[2,2-bis(benzenesulfonyl)-2-fluoroethyl]-N-methylaniline |
|---|---|
| PubChem CID | 102494666 |
| Molecular Formula | C21H20FNO4S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | N-[2,2-bis(benzenesulfonyl)-2-fluoroethyl]-N-methylaniline |
| SMILES | CN(CC(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20FNO4S2/c1-23(18-11-5-2-6-12-18)17-21(22,28(24,25)19-13-7-3-8-14-19)29(26,27)20-15-9-4-10-16-20/h2-16H,17H2,1H3 |
| InChIKey | URODXPVAUWSSSV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |