C18H21NO3S — CID 102476363
N-ethynyl-4-methyl-N-[4-(5-methylfuran-2-yl)butan-2-yl]benzenesulfonamide (PubChem CID 102476363) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-ethynyl-4-methyl-N-[4-(5-methylfuran-2-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | N-ethynyl-4-methyl-N-[4-(5-methylfuran-2-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 102476363 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-ethynyl-4-methyl-N-[4-(5-methylfuran-2-yl)butan-2-yl]benzenesulfonamide |
| SMILES | C#CN(C(C)CCc1ccc(C)o1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H21NO3S/c1-5-19(15(3)8-10-17-11-9-16(4)22-17)23(20,21)18-12-6-14(2)7-13-18/h1,6-7,9,11-13,15H,8,10H2,2-4H3 |
| InChIKey | ZRADPBVHQGALCU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|