C26H21F2NO5S — CID 3915146
[4-[[[2-(4-fluorophenyl)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3915146) has the molecular formula C26H21F2NO5S and a molecular weight of 497.52 g/mol. Its IUPAC name is [4-[[[2-(4-fluorophenyl)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[[2-(4-fluorophenyl)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3915146 |
| Molecular Formula | C26H21F2NO5S |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | [4-[[[2-(4-fluorophenyl)acetyl]-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(Cc1ccc(F)cc1)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C26H21F2NO5S/c27-21-7-3-19(4-8-21)16-26(30)29(18-24-2-1-15-33-24)17-20-5-11-23(12-6-20)34-35(31,32)25-13-9-22(28)10-14-25/h1-15H,16-18H2 |
| InChIKey | UCACVGUOULIQML-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|