About benzylazanium;(2R)-2-phenylpropanoate
benzylazanium;(2R)-2-phenylpropanoate (PubChem CID 139061083) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is benzylazanium;(2R)-2-phenylpropanoate.
Molecular Properties
| Compound Name | benzylazanium;(2R)-2-phenylpropanoate |
| PubChem CID | 139061083 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | benzylazanium;(2R)-2-phenylpropanoate |
| SMILES | C[C@@H](C(=O)[O-])c1ccccc1.[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C9H10O2.C7H9N/c1-7(9(10)11)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2-7H,1H3,(H,10,11);1-5H,6,8H2/t7-;/m1./s1 |
| InChIKey | UBJBLTOPULLCAW-OGFXRTJISA-N |
| XLogP | 0.97 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylazanium;(2R)-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;(2R)-2-phenylpropanoate?
The IUPAC name of benzylazanium;(2R)-2-phenylpropanoate (CID 139061083) is benzylazanium;(2R)-2-phenylpropanoate.
What is the SMILES notation for benzylazanium;(2R)-2-phenylpropanoate?
The canonical SMILES for benzylazanium;(2R)-2-phenylpropanoate is C[C@@H](C(=O)[O-])c1ccccc1.[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;(2R)-2-phenylpropanoate?
The InChIKey is UBJBLTOPULLCAW-OGFXRTJISA-N. The full InChI is InChI=1S/C9H10O2.C7H9N/c1-7(9(10)11)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2-7H,1H3,(H,10,11);1-5H,6,8H2/t7-;/m1./s1.
What are the key properties of benzylazanium;(2R)-2-phenylpropanoate?
benzylazanium;(2R)-2-phenylpropanoate has a molecular weight of 257.33 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;(2R)-2-phenylpropanoate is sourced from PubChem (CID 139061083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).