About benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium
benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium (PubChem CID 158819459) has the molecular formula C23H34N3+3
and a molecular weight of 352.55 g/mol. Its IUPAC name is benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium.
Molecular Properties
| Compound Name | benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium |
| PubChem CID | 158819459 |
| Molecular Formula | C23H34N3+3 |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH3+])c1ccccc1.C[C@H]([NH3+])c1ccccc1.[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/2C8H11N.C7H9N/c2*1-7(9)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2*2-7H,9H2,1H3;1-5H,6,8H2/p+3/t2*7-;/m10./s1 |
| InChIKey | IVRKECWUANPQPS-BGEHQDIKSA-Q |
| XLogP | 2.41 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium?
The IUPAC name of benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium (CID 158819459) is benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium.
What is the SMILES notation for benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium?
The canonical SMILES for benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium is C[C@@H]([NH3+])c1ccccc1.C[C@H]([NH3+])c1ccccc1.[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium?
The InChIKey is IVRKECWUANPQPS-BGEHQDIKSA-Q. The full InChI is InChI=1S/2C8H11N.C7H9N/c2*1-7(9)8-5-3-2-4-6-8;8-6-7-4-2-1-3-5-7/h2*2-7H,9H2,1H3;1-5H,6,8H2/p+3/t2*7-;/m10./s1.
What are the key properties of benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium?
benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium has a molecular weight of 352.55 g/mol, XLogP of 2.41, 3 rotatable bonds, 3 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;[(1R)-1-phenylethyl]azanium;[(1S)-1-phenylethyl]azanium is sourced from PubChem (CID 158819459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).