About benzylazanium;ethene;chloride
benzylazanium;ethene;chloride (PubChem CID 161138750) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is benzylazanium;ethene;chloride.
Molecular Properties
| Compound Name | benzylazanium;ethene;chloride |
| PubChem CID | 161138750 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | benzylazanium;ethene;chloride |
| SMILES | C=C.[Cl-].[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C7H9N.C2H4.ClH/c8-6-7-4-2-1-3-5-7;1-2;/h1-5H,6,8H2;1-2H2;1H |
| InChIKey | UNDNDOGJEHASFF-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzylazanium;ethene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;ethene;chloride?
The IUPAC name of benzylazanium;ethene;chloride (CID 161138750) is benzylazanium;ethene;chloride.
What is the SMILES notation for benzylazanium;ethene;chloride?
The canonical SMILES for benzylazanium;ethene;chloride is C=C.[Cl-].[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;ethene;chloride?
The InChIKey is UNDNDOGJEHASFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C2H4.ClH/c8-6-7-4-2-1-3-5-7;1-2;/h1-5H,6,8H2;1-2H2;1H.
What are the key properties of benzylazanium;ethene;chloride?
benzylazanium;ethene;chloride has a molecular weight of 171.67 g/mol, XLogP of -1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;ethene;chloride is sourced from PubChem (CID 161138750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).