About benzylazanium;2-carboxy-6-hydroxyphenolate
benzylazanium;2-carboxy-6-hydroxyphenolate (PubChem CID 86748165) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is benzylazanium;2-carboxy-6-hydroxyphenolate.
Molecular Properties
| Compound Name | benzylazanium;2-carboxy-6-hydroxyphenolate |
| PubChem CID | 86748165 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | benzylazanium;2-carboxy-6-hydroxyphenolate |
| SMILES | O=C(O)c1cccc(O)c1[O-].[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C7H9N.C7H6O4/c8-6-7-4-2-1-3-5-7;8-5-3-1-2-4(6(5)9)7(10)11/h1-5H,6,8H2;1-3,8-9H,(H,10,11) |
| InChIKey | PDLNLCCNHPJPLG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzylazanium;2-carboxy-6-hydroxyphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;2-carboxy-6-hydroxyphenolate?
The IUPAC name of benzylazanium;2-carboxy-6-hydroxyphenolate (CID 86748165) is benzylazanium;2-carboxy-6-hydroxyphenolate.
What is the SMILES notation for benzylazanium;2-carboxy-6-hydroxyphenolate?
The canonical SMILES for benzylazanium;2-carboxy-6-hydroxyphenolate is O=C(O)c1cccc(O)c1[O-].[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;2-carboxy-6-hydroxyphenolate?
The InChIKey is PDLNLCCNHPJPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C7H6O4/c8-6-7-4-2-1-3-5-7;8-5-3-1-2-4(6(5)9)7(10)11/h1-5H,6,8H2;1-3,8-9H,(H,10,11).
What are the key properties of benzylazanium;2-carboxy-6-hydroxyphenolate?
benzylazanium;2-carboxy-6-hydroxyphenolate has a molecular weight of 261.28 g/mol, XLogP of 0.59, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;2-carboxy-6-hydroxyphenolate is sourced from PubChem (CID 86748165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).