About calcium;hydrogen borate;2-hydroxybenzoic acid
calcium;hydrogen borate;2-hydroxybenzoic acid (PubChem CID 175224140) has the molecular formula C7H7BCaO6
and a molecular weight of 238.02 g/mol. Its IUPAC name is calcium;hydrogen borate;2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | calcium;hydrogen borate;2-hydroxybenzoic acid |
| PubChem CID | 175224140 |
| Molecular Formula | C7H7BCaO6 |
| Molecular Weight | 238.02 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | calcium;hydrogen borate;2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccccc1O.[Ca+2].[O-]B([O-])O |
| InChI | InChI=1S/C7H6O3.BHO3.Ca/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4;/h1-4,8H,(H,9,10);2H;/q;-2;+2 |
| InChIKey | BIELVOPLDLZSJC-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.02 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydrogen borate;2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydrogen borate;2-hydroxybenzoic acid?
The IUPAC name of calcium;hydrogen borate;2-hydroxybenzoic acid (CID 175224140) is calcium;hydrogen borate;2-hydroxybenzoic acid.
What is the SMILES notation for calcium;hydrogen borate;2-hydroxybenzoic acid?
The canonical SMILES for calcium;hydrogen borate;2-hydroxybenzoic acid is O=C(O)c1ccccc1O.[Ca+2].[O-]B([O-])O.
What is the InChIKey of calcium;hydrogen borate;2-hydroxybenzoic acid?
The InChIKey is BIELVOPLDLZSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.BHO3.Ca/c8-6-4-2-1-3-5(6)7(9)10;2-1(3)4;/h1-4,8H,(H,9,10);2H;/q;-2;+2.
What are the key properties of calcium;hydrogen borate;2-hydroxybenzoic acid?
calcium;hydrogen borate;2-hydroxybenzoic acid has a molecular weight of 238.02 g/mol, XLogP of -2.61, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydrogen borate;2-hydroxybenzoic acid is sourced from PubChem (CID 175224140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).