About benzylazanium;dioxotitanium;chloride
benzylazanium;dioxotitanium;chloride (PubChem CID 174858414) has the molecular formula C7H10ClNO2Ti
and a molecular weight of 223.48 g/mol. Its IUPAC name is benzylazanium;dioxotitanium;chloride.
Molecular Properties
| Compound Name | benzylazanium;dioxotitanium;chloride |
| PubChem CID | 174858414 |
| Molecular Formula | C7H10ClNO2Ti |
| Molecular Weight | 223.48 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | benzylazanium;dioxotitanium;chloride |
| SMILES | O=[Ti]=O.[Cl-].[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C7H9N.ClH.2O.Ti/c8-6-7-4-2-1-3-5-7;;;;/h1-5H,6,8H2;1H;;; |
| InChIKey | NYUANXFWTOSGDN-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.48 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzylazanium;dioxotitanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;dioxotitanium;chloride?
The IUPAC name of benzylazanium;dioxotitanium;chloride (CID 174858414) is benzylazanium;dioxotitanium;chloride.
What is the SMILES notation for benzylazanium;dioxotitanium;chloride?
The canonical SMILES for benzylazanium;dioxotitanium;chloride is O=[Ti]=O.[Cl-].[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;dioxotitanium;chloride?
The InChIKey is NYUANXFWTOSGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.ClH.2O.Ti/c8-6-7-4-2-1-3-5-7;;;;/h1-5H,6,8H2;1H;;;.
What are the key properties of benzylazanium;dioxotitanium;chloride?
benzylazanium;dioxotitanium;chloride has a molecular weight of 223.48 g/mol, XLogP of -2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;dioxotitanium;chloride is sourced from PubChem (CID 174858414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).