About 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene
6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene (PubChem CID 54693465) has the molecular formula C16H17O4-
and a molecular weight of 273.31 g/mol. Its IUPAC name is 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene.
Molecular Properties
| Compound Name | 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene |
| PubChem CID | 54693465 |
| Molecular Formula | C16H17O4- |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene |
| SMILES | CCc1ccccc1.Cc1c(O)ccc(C(=O)O)c1[O-] |
| InChI | InChI=1S/C8H8O4.C8H10/c1-4-6(9)3-2-5(7(4)10)8(11)12;1-2-8-6-4-3-5-7-8/h2-3,9-10H,1H3,(H,11,12);3-7H,2H2,1H3/p-1 |
| InChIKey | HFOASVUFWDMDPH-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene?
The IUPAC name of 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene (CID 54693465) is 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene.
What is the SMILES notation for 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene?
The canonical SMILES for 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene is CCc1ccccc1.Cc1c(O)ccc(C(=O)O)c1[O-].
What is the InChIKey of 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene?
The InChIKey is HFOASVUFWDMDPH-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O4.C8H10/c1-4-6(9)3-2-5(7(4)10)8(11)12;1-2-8-6-4-3-5-7-8/h2-3,9-10H,1H3,(H,11,12);3-7H,2H2,1H3/p-1.
What are the key properties of 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene?
6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene has a molecular weight of 273.31 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-carboxy-3-hydroxy-2-methylphenolate;ethylbenzene is sourced from PubChem (CID 54693465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).