C11H16NO3- — CID 54677135
2-carboxyphenolate;N,N-dimethylethanamine (PubChem CID 54677135) has the molecular formula C11H16NO3- and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-carboxyphenolate;N,N-dimethylethanamine.
| Compound Name | 2-carboxyphenolate;N,N-dimethylethanamine |
|---|---|
| PubChem CID | 54677135 |
| Molecular Formula | C11H16NO3- |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-carboxyphenolate;N,N-dimethylethanamine |
| SMILES | CCN(C)C.O=C(O)c1ccccc1[O-] |
| InChI | InChI=1S/C7H6O3.C4H11N/c8-6-4-2-1-3-5(6)7(9)10;1-4-5(2)3/h1-4,8H,(H,9,10);4H2,1-3H3/p-1 |
| InChIKey | CGBBCMIYHKTCRC-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |