About benzylazanium;2-nitrobenzoate
benzylazanium;2-nitrobenzoate (PubChem CID 139091257) has the molecular formula C14H14N2O4
and a molecular weight of 274.28 g/mol. Its IUPAC name is benzylazanium;2-nitrobenzoate.
Molecular Properties
| Compound Name | benzylazanium;2-nitrobenzoate |
| PubChem CID | 139091257 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | benzylazanium;2-nitrobenzoate |
| SMILES | O=C([O-])c1ccccc1[N+](=O)[O-].[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/C7H5NO4.C7H9N/c9-7(10)5-3-1-2-4-6(5)8(11)12;8-6-7-4-2-1-3-5-7/h1-4H,(H,9,10);1-5H,6,8H2 |
| InChIKey | HYVIWRLRBUCKDR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzylazanium;2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylazanium;2-nitrobenzoate?
The IUPAC name of benzylazanium;2-nitrobenzoate (CID 139091257) is benzylazanium;2-nitrobenzoate.
What is the SMILES notation for benzylazanium;2-nitrobenzoate?
The canonical SMILES for benzylazanium;2-nitrobenzoate is O=C([O-])c1ccccc1[N+](=O)[O-].[NH3+]Cc1ccccc1.
What is the InChIKey of benzylazanium;2-nitrobenzoate?
The InChIKey is HYVIWRLRBUCKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.C7H9N/c9-7(10)5-3-1-2-4-6(5)8(11)12;8-6-7-4-2-1-3-5-7/h1-4H,(H,9,10);1-5H,6,8H2.
What are the key properties of benzylazanium;2-nitrobenzoate?
benzylazanium;2-nitrobenzoate has a molecular weight of 274.28 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylazanium;2-nitrobenzoate is sourced from PubChem (CID 139091257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).