About diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate
diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate (PubChem CID 139059884) has the molecular formula C11H15N5O4
and a molecular weight of 281.27 g/mol. Its IUPAC name is diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate.
Molecular Properties
| Compound Name | diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate |
| PubChem CID | 139059884 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate |
| SMILES | CC(C)=N[NH+]=C(N)N.O=C([O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5NO4.C4H10N4/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3(2)7-8-4(5)6/h1-4H,(H,9,10);1-2H3,(H4,5,6,8) |
| InChIKey | FRYFPTFQAYRRQH-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate?
The IUPAC name of diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate (CID 139059884) is diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate.
What is the SMILES notation for diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate?
The canonical SMILES for diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate is CC(C)=N[NH+]=C(N)N.O=C([O-])c1ccccc1[N+](=O)[O-].
What is the InChIKey of diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate?
The InChIKey is FRYFPTFQAYRRQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO4.C4H10N4/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3(2)7-8-4(5)6/h1-4H,(H,9,10);1-2H3,(H4,5,6,8).
What are the key properties of diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate?
diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate has a molecular weight of 281.27 g/mol, XLogP of -2.31, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidene-(propan-2-ylideneamino)azanium;2-nitrobenzoate is sourced from PubChem (CID 139059884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).