C25H30BrNO3 — CID 23623389
2,2-diphenylacetate;(2-hydroxy-1-phenylethyl)-trimethylazanium;hydrobromide (PubChem CID 23623389) has the molecular formula C25H30BrNO3 and a molecular weight of 472.42 g/mol. Its IUPAC name is 2,2-diphenylacetate;(2-hydroxy-1-phenylethyl)-trimethylazanium;hydrobromide.
| Compound Name | 2,2-diphenylacetate;(2-hydroxy-1-phenylethyl)-trimethylazanium;hydrobromide |
|---|---|
| PubChem CID | 23623389 |
| Molecular Formula | C25H30BrNO3 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2,2-diphenylacetate;(2-hydroxy-1-phenylethyl)-trimethylazanium;hydrobromide |
| SMILES | Br.C[N+](C)(C)C(CO)c1ccccc1.O=C([O-])C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C11H18NO.BrH/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-12(2,3)11(9-13)10-7-5-4-6-8-10;/h1-10,13H,(H,15,16);4-8,11,13H,9H2,1-3H3;1H/q;+1;/p-1 |
| InChIKey | NHKSMVIYJFMKBY-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|