C12H13F5O3 — CID 103473939
1-(2-fluoro-4-methoxyphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103473939) has the molecular formula C12H13F5O3 and a molecular weight of 300.22 g/mol. Its IUPAC name is 1-(2-fluoro-4-methoxyphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(2-fluoro-4-methoxyphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103473939 |
| Molecular Formula | C12H13F5O3 |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(2-fluoro-4-methoxyphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | COc1ccc(C(O)COCC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C12H13F5O3/c1-19-7-2-3-8(9(13)4-7)10(18)5-20-6-12(16,17)11(14)15/h2-4,10-11,18H,5-6H2,1H3 |
| InChIKey | XJHCQCAQQTVRLD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|