C14H18F4O3 — CID 103473969
1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 103473969) has the molecular formula C14H18F4O3 and a molecular weight of 310.29 g/mol. Its IUPAC name is 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 103473969 |
| Molecular Formula | C14H18F4O3 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | COc1c(C(O)COCC(F)(F)C(F)F)ccc(C)c1C |
| InChI | InChI=1S/C14H18F4O3/c1-8-4-5-10(12(20-3)9(8)2)11(19)6-21-7-14(17,18)13(15)16/h4-5,11,13,19H,6-7H2,1-3H3 |
| InChIKey | QBYZUDDVOBZUPN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|