C14H19F4NO2 — CID 103475167
1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475167) has the molecular formula C14H19F4NO2 and a molecular weight of 309.30 g/mol. Its IUPAC name is 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475167 |
| Molecular Formula | C14H19F4NO2 |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(2-methoxy-3,4-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | COc1c(C(N)COCC(F)(F)C(F)F)ccc(C)c1C |
| InChI | InChI=1S/C14H19F4NO2/c1-8-4-5-10(12(20-3)9(8)2)11(19)6-21-7-14(17,18)13(15)16/h4-5,11,13H,6-7,19H2,1-3H3 |
| InChIKey | SGFAJGKPLJLANO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|