C13H15F3N2O2 — CID 103217797
[1-(5-methyl-1-benzofuran-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine (PubChem CID 103217797) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is [1-(5-methyl-1-benzofuran-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine.
| Compound Name | [1-(5-methyl-1-benzofuran-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103217797 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | [1-(5-methyl-1-benzofuran-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
| SMILES | Cc1ccc2oc(C(COCC(F)(F)F)NN)cc2c1 |
| InChI | InChI=1S/C13H15F3N2O2/c1-8-2-3-11-9(4-8)5-12(20-11)10(18-17)6-19-7-13(14,15)16/h2-5,10,18H,6-7,17H2,1H3 |
| InChIKey | QHHYBKARZINTIF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|