C13H14F4N2O2 — CID 103477764
[1-(1-benzofuran-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 103477764) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is [1-(1-benzofuran-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-(1-benzofuran-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477764 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1-(1-benzofuran-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H14F4N2O2/c14-12(15)13(16,17)7-20-6-9(19-18)11-5-8-3-1-2-4-10(8)21-11/h1-5,9,12,19H,6-7,18H2 |
| InChIKey | KNSCVBSUGVMMGT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|