C14H20F4N2O — CID 103477603
[2-(2,2,3,3-tetrafluoropropoxy)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine (PubChem CID 103477603) has the molecular formula C14H20F4N2O and a molecular weight of 308.32 g/mol. Its IUPAC name is [2-(2,2,3,3-tetrafluoropropoxy)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine.
| Compound Name | [2-(2,2,3,3-tetrafluoropropoxy)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477603 |
| Molecular Formula | C14H20F4N2O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [2-(2,2,3,3-tetrafluoropropoxy)-1-(2,4,5-trimethylphenyl)ethyl]hydrazine |
| SMILES | Cc1cc(C)c(C(COCC(F)(F)C(F)F)NN)cc1C |
| InChI | InChI=1S/C14H20F4N2O/c1-8-4-10(3)11(5-9(8)2)12(20-19)6-21-7-14(17,18)13(15)16/h4-5,12-13,20H,6-7,19H2,1-3H3 |
| InChIKey | HAELTOVTLXMYNZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|