C10H15BrF4N4O — CID 103477762
[1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 103477762) has the molecular formula C10H15BrF4N4O and a molecular weight of 363.15 g/mol. Its IUPAC name is [1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477762 |
| Molecular Formula | C10H15BrF4N4O |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | CCn1ncc(Br)c1C(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C10H15BrF4N4O/c1-2-19-8(6(11)3-17-19)7(18-16)4-20-5-10(14,15)9(12)13/h3,7,9,18H,2,4-5,16H2,1H3 |
| InChIKey | XQLZCHPQIANALH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|