C10H15BrF3N3O — CID 103148166
1-(4-bromo-1-ethylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103148166) has the molecular formula C10H15BrF3N3O and a molecular weight of 330.15 g/mol. Its IUPAC name is 1-(4-bromo-1-ethylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103148166 |
| Molecular Formula | C10H15BrF3N3O |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(4-bromo-1-ethylpyrazol-5-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CCn1ncc(Br)c1C(N)CCOCC(F)(F)F |
| InChI | InChI=1S/C10H15BrF3N3O/c1-2-17-9(7(11)5-16-17)8(15)3-4-18-6-10(12,13)14/h5,8H,2-4,6,15H2,1H3 |
| InChIKey | KXTFWVSFNCWIJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|