C12H19BrF3N3O2 — CID 103147566
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-ol (PubChem CID 103147566) has the molecular formula C12H19BrF3N3O2 and a molecular weight of 374.20 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-ol.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103147566 |
| Molecular Formula | C12H19BrF3N3O2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-3-(2,2,2-trifluoroethoxy)propan-1-ol |
| SMILES | CN(C)CCn1ncc(Br)c1C(O)CCOCC(F)(F)F |
| InChI | InChI=1S/C12H19BrF3N3O2/c1-18(2)4-5-19-11(9(13)7-17-19)10(20)3-6-21-8-12(14,15)16/h7,10,20H,3-6,8H2,1-2H3 |
| InChIKey | FRTHNLQFKPYXJS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|