C13H25BrN4O — CID 114665884
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(2-methylpropylamino)ethanol (PubChem CID 114665884) has the molecular formula C13H25BrN4O and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(2-methylpropylamino)ethanol.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(2-methylpropylamino)ethanol |
|---|---|
| PubChem CID | 114665884 |
| Molecular Formula | C13H25BrN4O |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-2-(2-methylpropylamino)ethanol |
| SMILES | CC(C)CNCC(O)c1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C13H25BrN4O/c1-10(2)7-15-9-12(19)13-11(14)8-16-18(13)6-5-17(3)4/h8,10,12,15,19H,5-7,9H2,1-4H3 |
| InChIKey | JDLZOILMHYSYHC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |