C13H25BrN4 — CID 114662828
N-[2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethyl]-2-methylpropan-1-amine (PubChem CID 114662828) has the molecular formula C13H25BrN4 and a molecular weight of 317.28 g/mol. Its IUPAC name is N-[2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114662828 |
| Molecular Formula | C13H25BrN4 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[2-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]ethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCc1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C13H25BrN4/c1-11(2)9-15-6-5-13-12(14)10-16-18(13)8-7-17(3)4/h10-11,15H,5-9H2,1-4H3 |
| InChIKey | DIPBXSOFUQLCJI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|