C13H24BrN3O — CID 114664927
1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-3-ol (PubChem CID 114664927) has the molecular formula C13H24BrN3O and a molecular weight of 318.26 g/mol. Its IUPAC name is 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-3-ol.
| Compound Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-3-ol |
|---|---|
| PubChem CID | 114664927 |
| Molecular Formula | C13H24BrN3O |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-3-ol |
| SMILES | CCCC(O)CCc1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C13H24BrN3O/c1-4-5-11(18)6-7-13-12(14)10-15-17(13)9-8-16(2)3/h10-11,18H,4-9H2,1-3H3 |
| InChIKey | YGOAJTXFSNXTDG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |