C11H21BrN4 — CID 114652132
N-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]propan-2-amine (PubChem CID 114652132) has the molecular formula C11H21BrN4 and a molecular weight of 289.22 g/mol. Its IUPAC name is N-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]propan-2-amine.
| Compound Name | N-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 114652132 |
| Molecular Formula | C11H21BrN4 |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[[4-bromo-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1c(Br)cnn1CCN(C)C |
| InChI | InChI=1S/C11H21BrN4/c1-9(2)13-8-11-10(12)7-14-16(11)6-5-15(3)4/h7,9,13H,5-6,8H2,1-4H3 |
| InChIKey | DEESPRUHSQXFAT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |