C10H19BrN4O — CID 105225084
[1-(4-bromo-1-ethylpyrazol-5-yl)-4-methoxybutyl]hydrazine (PubChem CID 105225084) has the molecular formula C10H19BrN4O and a molecular weight of 291.19 g/mol. Its IUPAC name is [1-(4-bromo-1-ethylpyrazol-5-yl)-4-methoxybutyl]hydrazine.
| Compound Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-4-methoxybutyl]hydrazine |
|---|---|
| PubChem CID | 105225084 |
| Molecular Formula | C10H19BrN4O |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [1-(4-bromo-1-ethylpyrazol-5-yl)-4-methoxybutyl]hydrazine |
| SMILES | CCn1ncc(Br)c1C(CCCOC)NN |
| InChI | InChI=1S/C10H19BrN4O/c1-3-15-10(8(11)7-13-15)9(14-12)5-4-6-16-2/h7,9,14H,3-6,12H2,1-2H3 |
| InChIKey | AFGZWUOYNCEDNS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|