C12H24BrN5 — CID 105244143
3-(4-bromo-1-ethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylpropan-1-amine (PubChem CID 105244143) has the molecular formula C12H24BrN5 and a molecular weight of 318.26 g/mol. Its IUPAC name is 3-(4-bromo-1-ethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylpropan-1-amine.
| Compound Name | 3-(4-bromo-1-ethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylpropan-1-amine |
|---|---|
| PubChem CID | 105244143 |
| Molecular Formula | C12H24BrN5 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-(4-bromo-1-ethylpyrazol-5-yl)-N,N-diethyl-3-hydrazinylpropan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1c(Br)cnn1CC |
| InChI | InChI=1S/C12H24BrN5/c1-4-17(5-2)8-7-11(16-14)12-10(13)9-15-18(12)6-3/h9,11,16H,4-8,14H2,1-3H3 |
| InChIKey | JSFBTXJEYDBIGF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|