C12H25N5O — CID 105244142
N,N-diethyl-3-hydrazinyl-3-(4-methoxy-1-methylpyrazol-5-yl)propan-1-amine (PubChem CID 105244142) has the molecular formula C12H25N5O and a molecular weight of 255.37 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-3-(4-methoxy-1-methylpyrazol-5-yl)propan-1-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-3-(4-methoxy-1-methylpyrazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 105244142 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-3-(4-methoxy-1-methylpyrazol-5-yl)propan-1-amine |
| SMILES | CCN(CC)CCC(NN)c1c(OC)cnn1C |
| InChI | InChI=1S/C12H25N5O/c1-5-17(6-2)8-7-10(15-13)12-11(18-4)9-14-16(12)3/h9-10,15H,5-8,13H2,1-4H3 |
| InChIKey | FEPCSMAVQGHVTG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|