C14H24N6O — CID 105339139
[1-(4-methoxy-1-methylpyrazol-5-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine (PubChem CID 105339139) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is [1-(4-methoxy-1-methylpyrazol-5-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [1-(4-methoxy-1-methylpyrazol-5-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105339139 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [1-(4-methoxy-1-methylpyrazol-5-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
| SMILES | COc1cnn(C)c1C(CCc1c(C)nn(C)c1C)NN |
| InChI | InChI=1S/C14H24N6O/c1-9-11(10(2)19(3)18-9)6-7-12(17-15)14-13(21-5)8-16-20(14)4/h8,12,17H,6-7,15H2,1-5H3 |
| InChIKey | UYZQMXYPJNUSGX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|