C14H22N6O — CID 105332696
[1-(3-methoxypyrazin-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine (PubChem CID 105332696) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is [1-(3-methoxypyrazin-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine.
| Compound Name | [1-(3-methoxypyrazin-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 105332696 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [1-(3-methoxypyrazin-2-yl)-3-(1,3,5-trimethylpyrazol-4-yl)propyl]hydrazine |
| SMILES | COc1nccnc1C(CCc1c(C)nn(C)c1C)NN |
| InChI | InChI=1S/C14H22N6O/c1-9-11(10(2)20(3)19-9)5-6-12(18-15)13-14(21-4)17-8-7-16-13/h7-8,12,18H,5-6,15H2,1-4H3 |
| InChIKey | RYFKIWNJDFKLNV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|