C10H13ClF4N4O — CID 103477811
5-chloro-3-[1-hydrazinyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-amine (PubChem CID 103477811) has the molecular formula C10H13ClF4N4O and a molecular weight of 316.69 g/mol. Its IUPAC name is 5-chloro-3-[1-hydrazinyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[1-hydrazinyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 103477811 |
| Molecular Formula | C10H13ClF4N4O |
| Molecular Weight | 316.69 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 5-chloro-3-[1-hydrazinyl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]pyridin-2-amine |
| SMILES | NNC(COCC(F)(F)C(F)F)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C10H13ClF4N4O/c11-5-1-6(8(16)18-2-5)7(19-17)3-20-4-10(14,15)9(12)13/h1-2,7,9,19H,3-4,17H2,(H2,16,18) |
| InChIKey | OBNYSXJUJVHBFF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.69 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|