C12H14ClN5 — CID 105212191
5-chloro-3-(1-hydrazinyl-2-pyridin-3-ylethyl)pyridin-2-amine (PubChem CID 105212191) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 5-chloro-3-(1-hydrazinyl-2-pyridin-3-ylethyl)pyridin-2-amine.
| Compound Name | 5-chloro-3-(1-hydrazinyl-2-pyridin-3-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105212191 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-chloro-3-(1-hydrazinyl-2-pyridin-3-ylethyl)pyridin-2-amine |
| SMILES | NNC(Cc1cccnc1)c1cc(Cl)cnc1N |
| InChI | InChI=1S/C12H14ClN5/c13-9-5-10(12(14)17-7-9)11(18-15)4-8-2-1-3-16-6-8/h1-3,5-7,11,18H,4,15H2,(H2,14,17) |
| InChIKey | XWVJHLLHSYMONH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|