C11H14N2O3S — CID 105337838
[1-(1-benzofuran-2-yl)-2-methylsulfonylethyl]hydrazine (PubChem CID 105337838) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is [1-(1-benzofuran-2-yl)-2-methylsulfonylethyl]hydrazine.
| Compound Name | [1-(1-benzofuran-2-yl)-2-methylsulfonylethyl]hydrazine |
|---|---|
| PubChem CID | 105337838 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [1-(1-benzofuran-2-yl)-2-methylsulfonylethyl]hydrazine |
| SMILES | CS(=O)(=O)CC(NN)c1cc2ccccc2o1 |
| InChI | InChI=1S/C11H14N2O3S/c1-17(14,15)7-9(13-12)11-6-8-4-2-3-5-10(8)16-11/h2-6,9,13H,7,12H2,1H3 |
| InChIKey | IKLZHRQUYQJCSU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|