C16H21NO3S — CID 64675092
1-(1-benzofuran-2-yl)-2-cyclopentylsulfonyl-N-methylethanamine (PubChem CID 64675092) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-cyclopentylsulfonyl-N-methylethanamine.
| Compound Name | 1-(1-benzofuran-2-yl)-2-cyclopentylsulfonyl-N-methylethanamine |
|---|---|
| PubChem CID | 64675092 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-cyclopentylsulfonyl-N-methylethanamine |
| SMILES | CNC(CS(=O)(=O)C1CCCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H21NO3S/c1-17-14(11-21(18,19)13-7-3-4-8-13)16-10-12-6-2-5-9-15(12)20-16/h2,5-6,9-10,13-14,17H,3-4,7-8,11H2,1H3 |
| InChIKey | XMKMYYHUIOEZIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |