C19H34N2 — CID 105298321
1-(2,4-dimethylphenyl)undecylhydrazine (PubChem CID 105298321) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)undecylhydrazine.
| Compound Name | 1-(2,4-dimethylphenyl)undecylhydrazine |
|---|---|
| PubChem CID | 105298321 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 1-(2,4-dimethylphenyl)undecylhydrazine |
| SMILES | CCCCCCCCCCC(NN)c1ccc(C)cc1C |
| InChI | InChI=1S/C19H34N2/c1-4-5-6-7-8-9-10-11-12-19(21-20)18-14-13-16(2)15-17(18)3/h13-15,19,21H,4-12,20H2,1-3H3 |
| InChIKey | CSFCDZUQBONJJW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|