C15H26N2 — CID 105293889
1-(2,3-dimethylphenyl)heptylhydrazine (PubChem CID 105293889) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)heptylhydrazine.
| Compound Name | 1-(2,3-dimethylphenyl)heptylhydrazine |
|---|---|
| PubChem CID | 105293889 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-(2,3-dimethylphenyl)heptylhydrazine |
| SMILES | CCCCCCC(NN)c1cccc(C)c1C |
| InChI | InChI=1S/C15H26N2/c1-4-5-6-7-11-15(17-16)14-10-8-9-12(2)13(14)3/h8-10,15,17H,4-7,11,16H2,1-3H3 |
| InChIKey | KQWMFFYOXRKEGA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|