C18H31N — CID 115832026
1-(2,3-dimethylphenyl)-N-ethyloctan-1-amine (PubChem CID 115832026) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-N-ethyloctan-1-amine.
| Compound Name | 1-(2,3-dimethylphenyl)-N-ethyloctan-1-amine |
|---|---|
| PubChem CID | 115832026 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-N-ethyloctan-1-amine |
| SMILES | CCCCCCCC(NCC)c1cccc(C)c1C |
| InChI | InChI=1S/C18H31N/c1-5-7-8-9-10-14-18(19-6-2)17-13-11-12-15(3)16(17)4/h11-13,18-19H,5-10,14H2,1-4H3 |
| InChIKey | UETUFRRDOGNZPN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|